C9H12F3N3O3 — CID 103212096
ethyl 5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-carboxylate (PubChem CID 103212096) has the molecular formula C9H12F3N3O3 and a molecular weight of 267.21 g/mol. Its IUPAC name is ethyl 5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 103212096 |
| Molecular Formula | C9H12F3N3O3 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | ethyl 5-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1n[nH]c(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3O3/c1-2-18-8(16)7-13-6(14-15-7)3-4-17-5-9(10,11)12/h2-5H2,1H3,(H,13,14,15) |
| InChIKey | LYBARPGAGKWBBX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|