C12H16FN3O2 — CID 123878643
ethyl 5-(2-ethylidene-4-fluoropent-3-enyl)-1H-1,2,4-triazole-3-carboxylate (PubChem CID 123878643) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is ethyl 5-(2-ethylidene-4-fluoropent-3-enyl)-1H-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 5-(2-ethylidene-4-fluoropent-3-enyl)-1H-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 123878643 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | ethyl 5-(2-ethylidene-4-fluoropent-3-enyl)-1H-1,2,4-triazole-3-carboxylate |
| SMILES | CC=C(C=C(C)F)Cc1nc(C(=O)OCC)n[nH]1 |
| InChI | InChI=1S/C12H16FN3O2/c1-4-9(6-8(3)13)7-10-14-11(16-15-10)12(17)18-5-2/h4,6H,5,7H2,1-3H3,(H,14,15,16) |
| InChIKey | GTCLAARCJCUUDN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|