C16H15BrN2OS — CID 107575784
3-(4-bromo-3,5-dimethylphenyl)-7-methoxy-1H-benzimidazole-2-thione (PubChem CID 107575784) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenyl)-7-methoxy-1H-benzimidazole-2-thione.
| Compound Name | 3-(4-bromo-3,5-dimethylphenyl)-7-methoxy-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107575784 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenyl)-7-methoxy-1H-benzimidazole-2-thione |
| SMILES | COc1cccc2c1[nH]c(=S)n2-c1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C16H15BrN2OS/c1-9-7-11(8-10(2)14(9)17)19-12-5-4-6-13(20-3)15(12)18-16(19)21/h4-8H,1-3H3,(H,18,21) |
| InChIKey | CSDDSICUGHDHJC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|