C12H13BrN2S — CID 107576712
3-(4-bromo-3,5-dimethylphenyl)-4-methyl-1H-imidazole-2-thione (PubChem CID 107576712) has the molecular formula C12H13BrN2S and a molecular weight of 297.22 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylphenyl)-4-methyl-1H-imidazole-2-thione.
| Compound Name | 3-(4-bromo-3,5-dimethylphenyl)-4-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 107576712 |
| Molecular Formula | C12H13BrN2S |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylphenyl)-4-methyl-1H-imidazole-2-thione |
| SMILES | Cc1cc(-n2c(C)c[nH]c2=S)cc(C)c1Br |
| InChI | InChI=1S/C12H13BrN2S/c1-7-4-10(5-8(2)11(7)13)15-9(3)6-14-12(15)16/h4-6H,1-3H3,(H,14,16) |
| InChIKey | KJJBOUCGZMFNRX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|