C16H30N2O4 — CID 10757659
tert-butyl (2S)-2-[[2-hydroxy-2-[(2S)-pyrrolidin-2-yl]acetyl]amino]-4-methylpentanoate (PubChem CID 10757659) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-hydroxy-2-[(2S)-pyrrolidin-2-yl]acetyl]amino]-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[[2-hydroxy-2-[(2S)-pyrrolidin-2-yl]acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 10757659 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | tert-butyl (2S)-2-[[2-hydroxy-2-[(2S)-pyrrolidin-2-yl]acetyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)C(O)[C@@H]1CCCN1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N2O4/c1-10(2)9-12(15(21)22-16(3,4)5)18-14(20)13(19)11-7-6-8-17-11/h10-13,17,19H,6-9H2,1-5H3,(H,18,20)/t11-,12-,13?/m0/s1 |
| InChIKey | IRYBRMFLGXCIFH-VYAYZGMFSA-N |
| XLogP | 0.97 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |