C9H17NO3 — CID 67425861
tert-butyl (2S)-2-(azetidin-2-yl)-2-hydroxyacetate (PubChem CID 67425861) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is tert-butyl (2S)-2-(azetidin-2-yl)-2-hydroxyacetate.
| Compound Name | tert-butyl (2S)-2-(azetidin-2-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 67425861 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | tert-butyl (2S)-2-(azetidin-2-yl)-2-hydroxyacetate |
| SMILES | CC(C)(C)OC(=O)[C@@H](O)C1CCN1 |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)7(11)6-4-5-10-6/h6-7,10-11H,4-5H2,1-3H3/t6?,7-/m0/s1 |
| InChIKey | SKCCDPSCKSMWKY-MLWJPKLSSA-N |
| XLogP | 0.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |