About 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate)
3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) (PubChem CID 175266908) has the molecular formula C20H40N2O5
and a molecular weight of 388.55 g/mol. Its IUPAC name is 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate).
Molecular Properties
| Compound Name | 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) |
| PubChem CID | 175266908 |
| Molecular Formula | C20H40N2O5 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) |
| SMILES | CCC(=O)OC(C)(C)C.CCC(=O)OC(C)(C)C.NCCC(=O)C1CCN1 |
| InChI | InChI=1S/2C7H14O2.C6H12N2O/c2*1-5-6(8)9-7(2,3)4;7-3-1-6(9)5-2-4-8-5/h2*5H2,1-4H3;5,8H,1-4,7H2 |
| InChIKey | YENXZWRNNQVGJK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate)?
The IUPAC name of 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) (CID 175266908) is 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate).
What is the SMILES notation for 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate)?
The canonical SMILES for 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) is CCC(=O)OC(C)(C)C.CCC(=O)OC(C)(C)C.NCCC(=O)C1CCN1.
What is the InChIKey of 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate)?
The InChIKey is YENXZWRNNQVGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H14O2.C6H12N2O/c2*1-5-6(8)9-7(2,3)4;7-3-1-6(9)5-2-4-8-5/h2*5H2,1-4H3;5,8H,1-4,7H2.
What are the key properties of 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate)?
3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) has a molecular weight of 388.55 g/mol, XLogP of 2.74, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(azetidin-2-yl)propan-1-one;bis(tert-butyl propanoate) is sourced from PubChem (CID 175266908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).