C13H15Cl2FN4 — CID 107577513
1-[1-(3,5-dichloro-4-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine (PubChem CID 107577513) has the molecular formula C13H15Cl2FN4 and a molecular weight of 317.20 g/mol. Its IUPAC name is 1-[1-(3,5-dichloro-4-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine.
| Compound Name | 1-[1-(3,5-dichloro-4-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 107577513 |
| Molecular Formula | C13H15Cl2FN4 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-[1-(3,5-dichloro-4-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1nnn(-c2cc(Cl)c(F)c(Cl)c2)c1C |
| InChI | InChI=1S/C13H15Cl2FN4/c1-4-17-7(2)13-8(3)20(19-18-13)9-5-10(14)12(16)11(15)6-9/h5-7,17H,4H2,1-3H3 |
| InChIKey | FFKIFCJGTYMWGN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|