C13H16BrFN4 — CID 43671415
1-[1-(5-bromo-2-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine (PubChem CID 43671415) has the molecular formula C13H16BrFN4 and a molecular weight of 327.20 g/mol. Its IUPAC name is 1-[1-(5-bromo-2-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine.
| Compound Name | 1-[1-(5-bromo-2-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 43671415 |
| Molecular Formula | C13H16BrFN4 |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-[1-(5-bromo-2-fluorophenyl)-5-methyltriazol-4-yl]-N-ethylethanamine |
| SMILES | CCNC(C)c1nnn(-c2cc(Br)ccc2F)c1C |
| InChI | InChI=1S/C13H16BrFN4/c1-4-16-8(2)13-9(3)19(18-17-13)12-7-10(14)5-6-11(12)15/h5-8,16H,4H2,1-3H3 |
| InChIKey | QZVQDEQBSYDEEK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |