C16H24N4 — CID 43671206
N-ethyl-1-[5-methyl-1-(2-propan-2-ylphenyl)triazol-4-yl]ethanamine (PubChem CID 43671206) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is N-ethyl-1-[5-methyl-1-(2-propan-2-ylphenyl)triazol-4-yl]ethanamine.
| Compound Name | N-ethyl-1-[5-methyl-1-(2-propan-2-ylphenyl)triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 43671206 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | N-ethyl-1-[5-methyl-1-(2-propan-2-ylphenyl)triazol-4-yl]ethanamine |
| SMILES | CCNC(C)c1nnn(-c2ccccc2C(C)C)c1C |
| InChI | InChI=1S/C16H24N4/c1-6-17-12(4)16-13(5)20(19-18-16)15-10-8-7-9-14(15)11(2)3/h7-12,17H,6H2,1-5H3 |
| InChIKey | SHXBRSUSCICUGE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |