C13H13Cl2FN2O2 — CID 107580202
1-(3,5-dichloro-4-fluorophenyl)-3-propylpiperazine-2,5-dione (PubChem CID 107580202) has the molecular formula C13H13Cl2FN2O2 and a molecular weight of 319.16 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-fluorophenyl)-3-propylpiperazine-2,5-dione.
| Compound Name | 1-(3,5-dichloro-4-fluorophenyl)-3-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107580202 |
| Molecular Formula | C13H13Cl2FN2O2 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-(3,5-dichloro-4-fluorophenyl)-3-propylpiperazine-2,5-dione |
| SMILES | CCCC1NC(=O)CN(c2cc(Cl)c(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C13H13Cl2FN2O2/c1-2-3-10-13(20)18(6-11(19)17-10)7-4-8(14)12(16)9(15)5-7/h4-5,10H,2-3,6H2,1H3,(H,17,19) |
| InChIKey | IVHVNBYOTCSMLB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|