C16H15BrN2S — CID 107582078
N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-bromo-5-methylaniline (PubChem CID 107582078) has the molecular formula C16H15BrN2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-bromo-5-methylaniline.
| Compound Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-bromo-5-methylaniline |
|---|---|
| PubChem CID | 107582078 |
| Molecular Formula | C16H15BrN2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-[1-(1,3-benzothiazol-2-yl)ethyl]-3-bromo-5-methylaniline |
| SMILES | Cc1cc(Br)cc(NC(C)c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C16H15BrN2S/c1-10-7-12(17)9-13(8-10)18-11(2)16-19-14-5-3-4-6-15(14)20-16/h3-9,11,18H,1-2H3 |
| InChIKey | YHMADZLVNUKNPB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |