C16H26BrNO — CID 10758637
(5S)-1-[(E)-2-bromonon-2-enyl]-5-prop-1-en-2-ylpyrrolidin-2-one (PubChem CID 10758637) has the molecular formula C16H26BrNO and a molecular weight of 328.29 g/mol. Its IUPAC name is (5S)-1-[(E)-2-bromonon-2-enyl]-5-prop-1-en-2-ylpyrrolidin-2-one.
| Compound Name | (5S)-1-[(E)-2-bromonon-2-enyl]-5-prop-1-en-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10758637 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (5S)-1-[(E)-2-bromonon-2-enyl]-5-prop-1-en-2-ylpyrrolidin-2-one |
| SMILES | C=C(C)[C@@H]1CCC(=O)N1C/C(Br)=C\CCCCCC |
| InChI | InChI=1S/C16H26BrNO/c1-4-5-6-7-8-9-14(17)12-18-15(13(2)3)10-11-16(18)19/h9,15H,2,4-8,10-12H2,1,3H3/b14-9+/t15-/m0/s1 |
| InChIKey | FRBLRBVJFALKDO-HNRFISLBSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|