C20H17NO4 — CID 10759224
(9-benzyl-4-oxo-2,3-dihydrofuro[2,3-b]quinolin-2-yl) acetate (PubChem CID 10759224) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is (9-benzyl-4-oxo-2,3-dihydrofuro[2,3-b]quinolin-2-yl) acetate.
| Compound Name | (9-benzyl-4-oxo-2,3-dihydrofuro[2,3-b]quinolin-2-yl) acetate |
|---|---|
| PubChem CID | 10759224 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (9-benzyl-4-oxo-2,3-dihydrofuro[2,3-b]quinolin-2-yl) acetate |
| SMILES | CC(=O)OC1Cc2c(n(Cc3ccccc3)c3ccccc3c2=O)O1 |
| InChI | InChI=1S/C20H17NO4/c1-13(22)24-18-11-16-19(23)15-9-5-6-10-17(15)21(20(16)25-18)12-14-7-3-2-4-8-14/h2-10,18H,11-12H2,1H3 |
| InChIKey | VLEONYCKPSDMRX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |