C20H32O4 — CID 10759326
[(3aS,4S,7Z,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxol-7-yl]methyl acetate (PubChem CID 10759326) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [(3aS,4S,7Z,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxol-7-yl]methyl acetate.
| Compound Name | [(3aS,4S,7Z,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxol-7-yl]methyl acetate |
|---|---|
| PubChem CID | 10759326 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(3aS,4S,7Z,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxol-7-yl]methyl acetate |
| SMILES | C=C1CC/C=C(\COC(C)=O)CC[C@@H](C(C)C)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C20H32O4/c1-13(2)17-11-10-16(12-22-15(4)21)9-7-8-14(3)18-19(17)24-20(5,6)23-18/h9,13,17-19H,3,7-8,10-12H2,1-2,4-6H3/b16-9-/t17-,18+,19-/m0/s1 |
| InChIKey | GIVOBBZWTCXFRH-OTLXLNQRSA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|