C12H12BrFN2 — CID 107594176
5-bromo-6-fluoro-N,3,8-trimethylquinolin-2-amine (PubChem CID 107594176) has the molecular formula C12H12BrFN2 and a molecular weight of 283.14 g/mol. Its IUPAC name is 5-bromo-6-fluoro-N,3,8-trimethylquinolin-2-amine.
| Compound Name | 5-bromo-6-fluoro-N,3,8-trimethylquinolin-2-amine |
|---|---|
| PubChem CID | 107594176 |
| Molecular Formula | C12H12BrFN2 |
| Molecular Weight | 283.14 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 5-bromo-6-fluoro-N,3,8-trimethylquinolin-2-amine |
| SMILES | CNc1nc2c(C)cc(F)c(Br)c2cc1C |
| InChI | InChI=1S/C12H12BrFN2/c1-6-5-9(14)10(13)8-4-7(2)12(15-3)16-11(6)8/h4-5H,1-3H3,(H,15,16) |
| InChIKey | HSYVKTIRTCLROF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.14 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |