C15H13Br2N — CID 107597685
N-(2,6-dibromophenyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 107597685) has the molecular formula C15H13Br2N and a molecular weight of 367.08 g/mol. Its IUPAC name is N-(2,6-dibromophenyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(2,6-dibromophenyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 107597685 |
| Molecular Formula | C15H13Br2N |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | N-(2,6-dibromophenyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | Brc1cccc(Br)c1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H13Br2N/c16-13-6-3-7-14(17)15(13)18-12-8-10-4-1-2-5-11(10)9-12/h1-7,12,18H,8-9H2 |
| InChIKey | MIQCYLXTMCRSOG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |