C13H18BrFN2 — CID 107600628
1-(2-bromo-6-fluorophenyl)-2,3-dimethylpiperidin-4-amine (PubChem CID 107600628) has the molecular formula C13H18BrFN2 and a molecular weight of 301.20 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)-2,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(2-bromo-6-fluorophenyl)-2,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 107600628 |
| Molecular Formula | C13H18BrFN2 |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)-2,3-dimethylpiperidin-4-amine |
| SMILES | CC1C(N)CCN(c2c(F)cccc2Br)C1C |
| InChI | InChI=1S/C13H18BrFN2/c1-8-9(2)17(7-6-12(8)16)13-10(14)4-3-5-11(13)15/h3-5,8-9,12H,6-7,16H2,1-2H3 |
| InChIKey | SQGDKUAWDDRSDV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |