C10H5BrFNO2 — CID 107600944
1-(2-bromo-6-fluorophenyl)pyrrole-2,5-dione (PubChem CID 107600944) has the molecular formula C10H5BrFNO2 and a molecular weight of 270.06 g/mol. Its IUPAC name is 1-(2-bromo-6-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(2-bromo-6-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 107600944 |
| Molecular Formula | C10H5BrFNO2 |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 268.95 |
| IUPAC Name | 1-(2-bromo-6-fluorophenyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1c(F)cccc1Br |
| InChI | InChI=1S/C10H5BrFNO2/c11-6-2-1-3-7(12)10(6)13-8(14)4-5-9(13)15/h1-5H |
| InChIKey | ONEBTRZVZYTLGH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|