C10H9N3O2 — CID 176820396
1-(2,6-diaminophenyl)pyrrole-2,5-dione (PubChem CID 176820396) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 1-(2,6-diaminophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(2,6-diaminophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 176820396 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 1-(2,6-diaminophenyl)pyrrole-2,5-dione |
| SMILES | Nc1cccc(N)c1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H9N3O2/c11-6-2-1-3-7(12)10(6)13-8(14)4-5-9(13)15/h1-5H,11-12H2 |
| InChIKey | RRNLPCONYPZPHI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|