C17H20N2O6 — CID 10760120
1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(1-phenylethyl)pyrimidine-2,4-dione (PubChem CID 10760120) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(1-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(1-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10760120 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-(1-phenylethyl)pyrimidine-2,4-dione |
| SMILES | CC(c1ccccc1)n1c(=O)ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c1=O |
| InChI | InChI=1S/C17H20N2O6/c1-10(11-5-3-2-4-6-11)19-13(21)7-8-18(17(19)24)16-15(23)14(22)12(9-20)25-16/h2-8,10,12,14-16,20,22-23H,9H2,1H3/t10?,12-,14-,15+,16-/m1/s1 |
| InChIKey | BBDQKGPLANMMLR-ZKQHRACUSA-N |
| XLogP | -0.77 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |