C12H17N3O6 — CID 141369923
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[[(E)-prop-1-enyl]amino]pyrimidine-2,4-dione (PubChem CID 141369923) has the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[[(E)-prop-1-enyl]amino]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[[(E)-prop-1-enyl]amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 141369923 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-[[(E)-prop-1-enyl]amino]pyrimidine-2,4-dione |
| SMILES | C/C=C/Nn1c(=O)ccn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1=O |
| InChI | InChI=1S/C12H17N3O6/c1-2-4-13-15-8(17)3-5-14(12(15)20)11-10(19)9(18)7(6-16)21-11/h2-5,7,9-11,13,16,18-19H,6H2,1H3/b4-2+/t7-,9-,10-,11-/m1/s1 |
| InChIKey | DZDWXRIAYMIVNJ-PAQVOVIBSA-N |
| XLogP | -2.30 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |