C15H13BrN2O3 — CID 10760200
3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-bromo-5-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 10760200) has the molecular formula C15H13BrN2O3 and a molecular weight of 349.18 g/mol. Its IUPAC name is 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-bromo-5-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-bromo-5-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 10760200 |
| Molecular Formula | C15H13BrN2O3 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-bromo-5-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1[nH]c(C(=O)O)c(/C=C/C(=O)Nc2ccccc2)c1Br |
| InChI | InChI=1S/C15H13BrN2O3/c1-9-13(16)11(14(17-9)15(20)21)7-8-12(19)18-10-5-3-2-4-6-10/h2-8,17H,1H3,(H,18,19)(H,20,21)/b8-7+ |
| InChIKey | WFQXQYIGSNZXJJ-BQYQJAHWSA-N |
| XLogP | 3.44 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|