C14H10Br2N2O3 — CID 10364439
3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5-dibromo-1H-pyrrole-2-carboxylic acid (PubChem CID 10364439) has the molecular formula C14H10Br2N2O3 and a molecular weight of 414.05 g/mol. Its IUPAC name is 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5-dibromo-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5-dibromo-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 10364439 |
| Molecular Formula | C14H10Br2N2O3 |
| Molecular Weight | 414.05 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4,5-dibromo-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(/C=C/c1c(C(=O)O)[nH]c(Br)c1Br)Nc1ccccc1 |
| InChI | InChI=1S/C14H10Br2N2O3/c15-11-9(12(14(20)21)18-13(11)16)6-7-10(19)17-8-4-2-1-3-5-8/h1-7,18H,(H,17,19)(H,20,21)/b7-6+ |
| InChIKey | UGNTUUQTMNBWLV-VOTSOKGWSA-N |
| XLogP | 3.89 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.05 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|