C16H15IN2O3 — CID 10645226
methyl 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-iodo-5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 10645226) has the molecular formula C16H15IN2O3 and a molecular weight of 410.21 g/mol. Its IUPAC name is methyl 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-iodo-5-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-iodo-5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10645226 |
| Molecular Formula | C16H15IN2O3 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | methyl 3-[(E)-3-anilino-3-oxoprop-1-enyl]-4-iodo-5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c(C)c(I)c1/C=C/C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H15IN2O3/c1-10-14(17)12(15(18-10)16(21)22-2)8-9-13(20)19-11-6-4-3-5-7-11/h3-9,18H,1-2H3,(H,19,20)/b9-8+ |
| InChIKey | HEZSQXYORCRYTM-CMDGGOBGSA-N |
| XLogP | 3.37 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|