C18H20N2O3 — CID 10781399
3-[(E)-3-anilino-3-oxoprop-1-enyl]-5-methyl-4-propan-2-yl-1H-pyrrole-2-carboxylic acid (PubChem CID 10781399) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-[(E)-3-anilino-3-oxoprop-1-enyl]-5-methyl-4-propan-2-yl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-5-methyl-4-propan-2-yl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 10781399 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 3-[(E)-3-anilino-3-oxoprop-1-enyl]-5-methyl-4-propan-2-yl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1[nH]c(C(=O)O)c(/C=C/C(=O)Nc2ccccc2)c1C(C)C |
| InChI | InChI=1S/C18H20N2O3/c1-11(2)16-12(3)19-17(18(22)23)14(16)9-10-15(21)20-13-7-5-4-6-8-13/h4-11,19H,1-3H3,(H,20,21)(H,22,23)/b10-9+ |
| InChIKey | BFYPCEBKUDDKRX-MDZDMXLPSA-N |
| XLogP | 3.80 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|