C13H14N4O4 — CID 107602542
1-[2-[(4-methoxy-6-methylpyrimidin-2-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 107602542) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-[2-[(4-methoxy-6-methylpyrimidin-2-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[(4-methoxy-6-methylpyrimidin-2-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 107602542 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[2-[(4-methoxy-6-methylpyrimidin-2-yl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | COc1cc(C)nc(NC(=O)Cn2cccc2C(=O)O)n1 |
| InChI | InChI=1S/C13H14N4O4/c1-8-6-11(21-2)16-13(14-8)15-10(18)7-17-5-3-4-9(17)12(19)20/h3-6H,7H2,1-2H3,(H,19,20)(H,14,15,16,18) |
| InChIKey | KCAGOSSOTFPKMO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |