C18H18F2N2O4 — CID 10761262
3-[(4-amino-2,2-difluoro-3-hydroxy-5-phenylpentanoyl)amino]benzoic acid (PubChem CID 10761262) has the molecular formula C18H18F2N2O4 and a molecular weight of 364.35 g/mol. Its IUPAC name is 3-[(4-amino-2,2-difluoro-3-hydroxy-5-phenylpentanoyl)amino]benzoic acid.
| Compound Name | 3-[(4-amino-2,2-difluoro-3-hydroxy-5-phenylpentanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 10761262 |
| Molecular Formula | C18H18F2N2O4 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-[(4-amino-2,2-difluoro-3-hydroxy-5-phenylpentanoyl)amino]benzoic acid |
| SMILES | NC(Cc1ccccc1)C(O)C(F)(F)C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C18H18F2N2O4/c19-18(20,15(23)14(21)9-11-5-2-1-3-6-11)17(26)22-13-8-4-7-12(10-13)16(24)25/h1-8,10,14-15,23H,9,21H2,(H,22,26)(H,24,25) |
| InChIKey | DIDAKAYZIAEMLO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |