C16H24F2N2O2 — CID 10805210
4-amino-2,2-difluoro-3-hydroxy-N-pentyl-5-phenylpentanamide (PubChem CID 10805210) has the molecular formula C16H24F2N2O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-amino-2,2-difluoro-3-hydroxy-N-pentyl-5-phenylpentanamide.
| Compound Name | 4-amino-2,2-difluoro-3-hydroxy-N-pentyl-5-phenylpentanamide |
|---|---|
| PubChem CID | 10805210 |
| Molecular Formula | C16H24F2N2O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-amino-2,2-difluoro-3-hydroxy-N-pentyl-5-phenylpentanamide |
| SMILES | CCCCCNC(=O)C(F)(F)C(O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C16H24F2N2O2/c1-2-3-7-10-20-15(22)16(17,18)14(21)13(19)11-12-8-5-4-6-9-12/h4-6,8-9,13-14,21H,2-3,7,10-11,19H2,1H3,(H,20,22) |
| InChIKey | FSKXCEIMJITSEF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|