C18H13NO8 — CID 10761725
(2R)-2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)-2-phenylacetic acid (PubChem CID 10761725) has the molecular formula C18H13NO8 and a molecular weight of 371.30 g/mol. Its IUPAC name is (2R)-2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)-2-phenylacetic acid.
| Compound Name | (2R)-2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 10761725 |
| Molecular Formula | C18H13NO8 |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (2R)-2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)-2-phenylacetic acid |
| SMILES | COC(=O)Oc1cccc2c(=O)n([C@@H](C(=O)O)c3ccccc3)c(=O)oc12 |
| InChI | InChI=1S/C18H13NO8/c1-25-18(24)26-12-9-5-8-11-14(12)27-17(23)19(15(11)20)13(16(21)22)10-6-3-2-4-7-10/h2-9,13H,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | DWBOGNCTTKJPDS-CYBMUJFWSA-N |
| XLogP | 1.77 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|