C15H22O9S — CID 10762194
[(2R,3S,4R,5R,6R)-4,5-diacetyloxy-3-acetylsulfanyl-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 10762194) has the molecular formula C15H22O9S and a molecular weight of 378.40 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4,5-diacetyloxy-3-acetylsulfanyl-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-4,5-diacetyloxy-3-acetylsulfanyl-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10762194 |
| Molecular Formula | C15H22O9S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4,5-diacetyloxy-3-acetylsulfanyl-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@H](COC(C)=O)[C@H](SC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O9S/c1-7(16)21-6-11-14(25-10(4)19)12(22-8(2)17)13(23-9(3)18)15(20-5)24-11/h11-15H,6H2,1-5H3/t11-,12-,13-,14+,15-/m1/s1 |
| InChIKey | FRLSVFOIWMNCEM-ARILJUKYSA-N |
| XLogP | 0.43 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|