C15H19ClN2O — CID 107623092
6-chloro-N,2-diethyl-7-methoxy-3-methylquinolin-4-amine (PubChem CID 107623092) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 6-chloro-N,2-diethyl-7-methoxy-3-methylquinolin-4-amine.
| Compound Name | 6-chloro-N,2-diethyl-7-methoxy-3-methylquinolin-4-amine |
|---|---|
| PubChem CID | 107623092 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 6-chloro-N,2-diethyl-7-methoxy-3-methylquinolin-4-amine |
| SMILES | CCNc1c(C)c(CC)nc2cc(OC)c(Cl)cc12 |
| InChI | InChI=1S/C15H19ClN2O/c1-5-12-9(3)15(17-6-2)10-7-11(16)14(19-4)8-13(10)18-12/h7-8H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | PXXVSAXSKSDVAD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |