C13H14ClNO — CID 107628016
8-chloro-2-ethyl-3,5-dimethyl-1H-quinolin-4-one (PubChem CID 107628016) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is 8-chloro-2-ethyl-3,5-dimethyl-1H-quinolin-4-one.
| Compound Name | 8-chloro-2-ethyl-3,5-dimethyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 107628016 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 8-chloro-2-ethyl-3,5-dimethyl-1H-quinolin-4-one |
| SMILES | CCc1[nH]c2c(Cl)ccc(C)c2c(=O)c1C |
| InChI | InChI=1S/C13H14ClNO/c1-4-10-8(3)13(16)11-7(2)5-6-9(14)12(11)15-10/h5-6H,4H2,1-3H3,(H,15,16) |
| InChIKey | ZKNCKUMNEXIPDW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |