C12H11F2NO — CID 63561471
2-ethyl-7,8-difluoro-3-methyl-1H-quinolin-4-one (PubChem CID 63561471) has the molecular formula C12H11F2NO and a molecular weight of 223.22 g/mol. Its IUPAC name is 2-ethyl-7,8-difluoro-3-methyl-1H-quinolin-4-one.
| Compound Name | 2-ethyl-7,8-difluoro-3-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 63561471 |
| Molecular Formula | C12H11F2NO |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-ethyl-7,8-difluoro-3-methyl-1H-quinolin-4-one |
| SMILES | CCc1[nH]c2c(F)c(F)ccc2c(=O)c1C |
| InChI | InChI=1S/C12H11F2NO/c1-3-9-6(2)12(16)7-4-5-8(13)10(14)11(7)15-9/h4-5H,3H2,1-2H3,(H,15,16) |
| InChIKey | MXBIXKHCLCHQEB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |