C10H8ClIN4O — CID 107629560
N-(4-chloro-2-iodophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 107629560) has the molecular formula C10H8ClIN4O and a molecular weight of 362.56 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 107629560 |
| Molecular Formula | C10H8ClIN4O |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-5-methyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(Cl)cc2I)n[nH]1 |
| InChI | InChI=1S/C10H8ClIN4O/c1-5-13-9(16-15-5)10(17)14-8-3-2-6(11)4-7(8)12/h2-4H,1H3,(H,14,17)(H,13,15,16) |
| InChIKey | XYPHRVBOMSWLJN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|