C17H16BrN3 — CID 107633720
4-N-(3-bromo-2-methylphenyl)-2-methylquinoline-4,6-diamine (PubChem CID 107633720) has the molecular formula C17H16BrN3 and a molecular weight of 342.24 g/mol. Its IUPAC name is 4-N-(3-bromo-2-methylphenyl)-2-methylquinoline-4,6-diamine.
| Compound Name | 4-N-(3-bromo-2-methylphenyl)-2-methylquinoline-4,6-diamine |
|---|---|
| PubChem CID | 107633720 |
| Molecular Formula | C17H16BrN3 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-N-(3-bromo-2-methylphenyl)-2-methylquinoline-4,6-diamine |
| SMILES | Cc1cc(Nc2cccc(Br)c2C)c2cc(N)ccc2n1 |
| InChI | InChI=1S/C17H16BrN3/c1-10-8-17(13-9-12(19)6-7-16(13)20-10)21-15-5-3-4-14(18)11(15)2/h3-9H,19H2,1-2H3,(H,20,21) |
| InChIKey | QOXHAGXIVGSUBP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|