C16H13ClIN3 — CID 107635244
2-(4-chloro-2-iodoanilino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 107635244) has the molecular formula C16H13ClIN3 and a molecular weight of 409.66 g/mol. Its IUPAC name is 2-(4-chloro-2-iodoanilino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(4-chloro-2-iodoanilino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 107635244 |
| Molecular Formula | C16H13ClIN3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | 2-(4-chloro-2-iodoanilino)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1Nc1ccc(Cl)cc1I)CCCC2 |
| InChI | InChI=1S/C16H13ClIN3/c17-12-5-6-15(13(18)8-12)21-16-11(9-19)7-10-3-1-2-4-14(10)20-16/h5-8H,1-4H2,(H,20,21) |
| InChIKey | FUMSHPRDBHVDEP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|