C15H18ClIN2O2 — CID 107640281
1-(4-chloro-2-iodophenyl)-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 107640281) has the molecular formula C15H18ClIN2O2 and a molecular weight of 420.68 g/mol. Its IUPAC name is 1-(4-chloro-2-iodophenyl)-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-(4-chloro-2-iodophenyl)-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107640281 |
| Molecular Formula | C15H18ClIN2O2 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 1-(4-chloro-2-iodophenyl)-3,3-dimethyl-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C1C(=O)NC(C)(C)C(=O)N1c1ccc(Cl)cc1I |
| InChI | InChI=1S/C15H18ClIN2O2/c1-8(2)12-13(20)18-15(3,4)14(21)19(12)11-6-5-9(16)7-10(11)17/h5-8,12H,1-4H3,(H,18,20) |
| InChIKey | NCTZMQLIJVTGNQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|