C12H11F4NO3 — CID 107641460
2,2-dimethyl-4-oxo-4-(2,3,5,6-tetrafluoroanilino)butanoic acid (PubChem CID 107641460) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-4-(2,3,5,6-tetrafluoroanilino)butanoic acid.
| Compound Name | 2,2-dimethyl-4-oxo-4-(2,3,5,6-tetrafluoroanilino)butanoic acid |
|---|---|
| PubChem CID | 107641460 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2,2-dimethyl-4-oxo-4-(2,3,5,6-tetrafluoroanilino)butanoic acid |
| SMILES | CC(C)(CC(=O)Nc1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H11F4NO3/c1-12(2,11(19)20)4-7(18)17-10-8(15)5(13)3-6(14)9(10)16/h3H,4H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | DMJRNYVWFWYSHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|