C13H10F4N2O — CID 107643367
3-methoxy-1-N-(2,3,5,6-tetrafluorophenyl)benzene-1,2-diamine (PubChem CID 107643367) has the molecular formula C13H10F4N2O and a molecular weight of 286.23 g/mol. Its IUPAC name is 3-methoxy-1-N-(2,3,5,6-tetrafluorophenyl)benzene-1,2-diamine.
| Compound Name | 3-methoxy-1-N-(2,3,5,6-tetrafluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 107643367 |
| Molecular Formula | C13H10F4N2O |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-methoxy-1-N-(2,3,5,6-tetrafluorophenyl)benzene-1,2-diamine |
| SMILES | COc1cccc(Nc2c(F)c(F)cc(F)c2F)c1N |
| InChI | InChI=1S/C13H10F4N2O/c1-20-9-4-2-3-8(12(9)18)19-13-10(16)6(14)5-7(15)11(13)17/h2-5,19H,18H2,1H3 |
| InChIKey | WQQFOGKVJXRNJD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|