C11H12N4S — CID 107643432
4-N-(2-methylsulfanylphenyl)pyrimidine-4,5-diamine (PubChem CID 107643432) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 4-N-(2-methylsulfanylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-methylsulfanylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 107643432 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 4-N-(2-methylsulfanylphenyl)pyrimidine-4,5-diamine |
| SMILES | CSc1ccccc1Nc1ncncc1N |
| InChI | InChI=1S/C11H12N4S/c1-16-10-5-3-2-4-9(10)15-11-8(12)6-13-7-14-11/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | OVJOXORGQRCMPX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |