C16H12N6O4S2 — CID 10764373
1-N,4-N-bis[(2-cyanoacetyl)carbamothioyl]benzene-1,4-dicarboxamide (PubChem CID 10764373) has the molecular formula C16H12N6O4S2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-N,4-N-bis[(2-cyanoacetyl)carbamothioyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(2-cyanoacetyl)carbamothioyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 10764373 |
| Molecular Formula | C16H12N6O4S2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-N,4-N-bis[(2-cyanoacetyl)carbamothioyl]benzene-1,4-dicarboxamide |
| SMILES | N#CCC(=O)NC(=S)NC(=O)c1ccc(C(=O)NC(=S)NC(=O)CC#N)cc1 |
| InChI | InChI=1S/C16H12N6O4S2/c17-7-5-11(23)19-15(27)21-13(25)9-1-2-10(4-3-9)14(26)22-16(28)20-12(24)6-8-18/h1-4H,5-6H2,(H2,19,21,23,25,27)(H2,20,22,24,26,28) |
| InChIKey | FXYOVBLVIWXEQJ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 163.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|