C12H9N5O2S — CID 3003303
4-cyano-N-[[(2-cyanoacetyl)amino]carbamothioyl]benzamide (PubChem CID 3003303) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is 4-cyano-N-[[(2-cyanoacetyl)amino]carbamothioyl]benzamide.
| Compound Name | 4-cyano-N-[[(2-cyanoacetyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3003303 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-cyano-N-[[(2-cyanoacetyl)amino]carbamothioyl]benzamide |
| SMILES | N#CCC(=O)NNC(=S)NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H9N5O2S/c13-6-5-10(18)16-17-12(20)15-11(19)9-3-1-8(7-14)2-4-9/h1-4H,5H2,(H,16,18)(H2,15,17,19,20) |
| InChIKey | MOTIYZUMYXTXCB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|