C12H10F4N2 — CID 107644461
2-[1-[(2,3,5,6-tetrafluoroanilino)methyl]cyclopropyl]acetonitrile (PubChem CID 107644461) has the molecular formula C12H10F4N2 and a molecular weight of 258.22 g/mol. Its IUPAC name is 2-[1-[(2,3,5,6-tetrafluoroanilino)methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[(2,3,5,6-tetrafluoroanilino)methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 107644461 |
| Molecular Formula | C12H10F4N2 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[1-[(2,3,5,6-tetrafluoroanilino)methyl]cyclopropyl]acetonitrile |
| SMILES | N#CCC1(CNc2c(F)c(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C12H10F4N2/c13-7-5-8(14)10(16)11(9(7)15)18-6-12(1-2-12)3-4-17/h5,18H,1-3,6H2 |
| InChIKey | VPCSBGVREPANDB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|