C14H14F4N2 — CID 107644498
2-(2,3,5,6-tetrafluoroanilino)cycloheptane-1-carbonitrile (PubChem CID 107644498) has the molecular formula C14H14F4N2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 2-(2,3,5,6-tetrafluoroanilino)cycloheptane-1-carbonitrile.
| Compound Name | 2-(2,3,5,6-tetrafluoroanilino)cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 107644498 |
| Molecular Formula | C14H14F4N2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2-(2,3,5,6-tetrafluoroanilino)cycloheptane-1-carbonitrile |
| SMILES | N#CC1CCCCCC1Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H14F4N2/c15-9-6-10(16)13(18)14(12(9)17)20-11-5-3-1-2-4-8(11)7-19/h6,8,11,20H,1-5H2 |
| InChIKey | RAOUFQDETHGXSU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|