C12H11F3N2 — CID 62810465
2-(3,4,5-trifluoroanilino)cyclopentane-1-carbonitrile (PubChem CID 62810465) has the molecular formula C12H11F3N2 and a molecular weight of 240.23 g/mol. Its IUPAC name is 2-(3,4,5-trifluoroanilino)cyclopentane-1-carbonitrile.
| Compound Name | 2-(3,4,5-trifluoroanilino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 62810465 |
| Molecular Formula | C12H11F3N2 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(3,4,5-trifluoroanilino)cyclopentane-1-carbonitrile |
| SMILES | N#CC1CCCC1Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H11F3N2/c13-9-4-8(5-10(14)12(9)15)17-11-3-1-2-7(11)6-16/h4-5,7,11,17H,1-3H2 |
| InChIKey | QIPOGSMZKSBZEQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|