C13H8F4N4 — CID 107645385
6-methyl-3-(2,3,5,6-tetrafluorophenyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 107645385) has the molecular formula C13H8F4N4 and a molecular weight of 296.23 g/mol. Its IUPAC name is 6-methyl-3-(2,3,5,6-tetrafluorophenyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 6-methyl-3-(2,3,5,6-tetrafluorophenyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 107645385 |
| Molecular Formula | C13H8F4N4 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 6-methyl-3-(2,3,5,6-tetrafluorophenyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1cnc2c(c1)nc(N)n2-c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H8F4N4/c1-5-2-8-12(19-4-5)21(13(18)20-8)11-9(16)6(14)3-7(15)10(11)17/h2-4H,1H3,(H2,18,20) |
| InChIKey | HHWWDYJGWCMNHU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|