C13H11IN4 — CID 79300966
3-(4-iodophenyl)-6-methylimidazo[4,5-b]pyridin-2-amine (PubChem CID 79300966) has the molecular formula C13H11IN4 and a molecular weight of 350.16 g/mol. Its IUPAC name is 3-(4-iodophenyl)-6-methylimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(4-iodophenyl)-6-methylimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 79300966 |
| Molecular Formula | C13H11IN4 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 3-(4-iodophenyl)-6-methylimidazo[4,5-b]pyridin-2-amine |
| SMILES | Cc1cnc2c(c1)nc(N)n2-c1ccc(I)cc1 |
| InChI | InChI=1S/C13H11IN4/c1-8-6-11-12(16-7-8)18(13(15)17-11)10-4-2-9(14)3-5-10/h2-7H,1H3,(H2,15,17) |
| InChIKey | BAOTUVHLGLOCCP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|