C9H8F4N2 — CID 107646072
N'-(2,3,5,6-tetrafluorophenyl)propanimidamide (PubChem CID 107646072) has the molecular formula C9H8F4N2 and a molecular weight of 220.17 g/mol. Its IUPAC name is N'-(2,3,5,6-tetrafluorophenyl)propanimidamide.
| Compound Name | N'-(2,3,5,6-tetrafluorophenyl)propanimidamide |
|---|---|
| PubChem CID | 107646072 |
| Molecular Formula | C9H8F4N2 |
| Molecular Weight | 220.17 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | N'-(2,3,5,6-tetrafluorophenyl)propanimidamide |
| SMILES | CC/C(N)=N\c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H8F4N2/c1-2-6(14)15-9-7(12)4(10)3-5(11)8(9)13/h3H,2H2,1H3,(H2,14,15) |
| InChIKey | AXVBFYHTLDGHJR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|