C15H19N3OS — CID 107647982
3-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol (PubChem CID 107647982) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 3-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 107647982 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-1,7-dimethyl-2,3-dihydro-1H-inden-4-ol |
| SMILES | CCc1nnc(NC2CC(C)c3c(C)ccc(O)c32)s1 |
| InChI | InChI=1S/C15H19N3OS/c1-4-12-17-18-15(20-12)16-10-7-9(3)13-8(2)5-6-11(19)14(10)13/h5-6,9-10,19H,4,7H2,1-3H3,(H,16,18) |
| InChIKey | AHAIKMMXLPTMFE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|